{{Drugbox | Verifiedfields = changed | verifiedrevid = 464199140 | IUPAC_name = (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]-octahydro-1H-indole-2-carboxylic acid | image = Perindopril structure.svg | width = 222

| tradename = Coversyl, Coversum, Preterax, Aceon | Drugs.com = monograph | MedlinePlus = a602017 | pregnancy_US = D | legal_US = Rx-only | routes_of_administration = Oral

| bioavailability = 24% | protein_bound = 20% | metabolism = Renal | elimination_half-life = 1–17 hours for perindoprilat (active metabolite)

| IUPHAR_ligand = 6367 | CAS_number_Ref =  ☒N | CAS_number = 82834-16-0 | ATC_prefix = C09 | ATC_suffix = AA04 | ATC_supplemental =
C09BA04 (with diuretics)
C09BB04 (with amlodipine) | PubChem = 107807 | DrugBank_Ref =  ☑Y | DrugBank = DB00790 | ChemSpiderID_Ref =  ☑Y | ChemSpiderID = 96956 | UNII_Ref =  ☒N | UNII = 1964X464OJ | KEGG_Ref =  ☑Y | KEGG = D03753 | ChEBI_Ref =  ☑Y | ChEBI = 8024 | ChEMBL_Ref =  ☑Y | ChEMBL = 1581

| C=19 | H=32 | N=2 | O=5 | molecular_weight = 368.468 g/mol | smiles = O=C(OCC)[C@@H](N[C@H](C(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@H]12)C)CCC | InChI = 1/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | InChIKey = IPVQLZZIHOAWMC-QXKUPLGCBD | StdInChI_Ref =  ☑Y | StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | StdInChIKey_Ref =  ☑Y | StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N }}

പെരിൻഡോപ്രിൽഅഥവാ പെരിണ്ടോപ്രിൽ ഒരു ദീർഘകർമ്മശേഷിയുള്ള ഏസ് ഇൻഹിബിറ്റർ ഔഷദമാണ്. രക്താതിമർദ്ദം, ഹൃദയാഘാതം, വൃക്കരോഗങ്ങൾ എന്നിവക്കുള്ള ഔഷദമായണ് ഇവ [1] പെരിൻടോപ്രിൽ അർജ്ജിനൈൻ ആയിട്ടോ (വ്യാപാരനാമങ്ങൾ കവേർസിൽ, കവേർസം) അല്ലെങ്കിൽപെരിൻടോപ്രിൽ എർബുമീനായോ (ഏസിയോൺ) നിർമ്മിക്കുന്നു . ആസ്റ്റ്രേറലിയൻ സർക്കാരിന്റെ ഔഷദങ്ങളെക്കുറിച്ചുള്ള വെബ്സൈറ്റിൽ ഈ രണ്ടും തരവും ഒരേ ഉപയോഗമുള്ളതായിട്ടണ് കണ്ടെത്തിയിരിക്കുന്നത്. [2] However, the dose prescribed to achieve the same effect differs due to different molecular weights for the two forms.

ഔഷദോപയോഗങ്ങൾതിരുത്തുക

ഏസ് ഇൻഹിബിറ്റർ വർഗ്ഗത്തിൽ പെടുന്നവയാണ് ഈ മരുന്ന്. ഏസ് ഇൻഹിബിറ്ററുകൾ ഉപയോഗിക്കാവുന്ന എല്ലാ അസുഖങ്ങൾക്കും ഇവ ഉപയോഗിക്കുന്നുണ്ട്. രക്താതിമർദ്ദം, ഹൃദയാഘാതത്തിൽ നിന്ന് സംരക്ഷണം, നിലക്കുന്ന ഹൃദയരോഗത്തിനെതിരെയും, രക്തം കട്ടപിടിച്ച ഹൃദയരക്തക്കുഴലുകളെ പൂർവ്വസ്ഥിതിയിലാക്കുക തുടങ്ങിയ പ്രശ്നങ്ങൾക്കാണ് പെരിണ്ടോപ്രിൽ ഉപയോഗിച്ചു വരുന്നത്. ഇതു കൂടാതെ, രക്താതിമർദ്ദം മൂലവും അല്ലാതെയും ഉണ്ടാകാവുന്ന സ്ട്രോക്കിനെതിരെയും ഫലപ്രദമാണെന്നും കണ്ടെത്തിയിട്ടുണ്ട്.[3]

പരാമർശങ്ങൾതിരുത്തുക

  1. Royal Australian College of General Practitioners. "Consumer Medicine Information, GenRx Perindopril" (PDF). Clinical Resources, Medicine information for health professionals.
  2. Australian Government Department of Health and Ageing (2008). "PBS For Health Professionals". Pharmaceutical Benefits Scheme. ശേഖരിച്ചത് 2008-09-04.
  3. PROGRESS Collaborative Group. "Randomised trial of a perindopril-based blood-pressure-lowering regimen among 6,105 individuals with previous stroke or transient ischaemic attack". The Lancet. 2001 Sep 29;. 358 (9287): 1033–1041. doi:10.1016/s0140-6736(01)06178-5. PMID 11589932.CS1 maint: extra punctuation (link)
"https://ml.wikipedia.org/w/index.php?title=പെരിണ്ടോപ്രിൽ&oldid=2362309" എന്ന താളിൽനിന്ന് ശേഖരിച്ചത്