"മോർഫിൻ" എന്ന താളിന്റെ പതിപ്പുകൾ തമ്മിലുള്ള വ്യത്യാസം

2,684 ബൈറ്റുകൾ കൂട്ടിച്ചേർത്തിരിക്കുന്നു ,  8 വർഷം മുമ്പ്
തിരുത്തലിനു സംഗ്രഹമില്ല
No edit summary
No edit summary
 
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 477170110
| IUPAC_name = (5α,6α)-7,8-didehydro-<br />4,5-epoxy-17-methyl[[morphinan]]-3,6-diol
| image = Morphin - Morphine.svg
| image2 = Morphine3Dan.gif
 
<!--Clinical data-->
| tradename = Mscontin, Oramorph, Sevredol(Morphine as a sulfate)
| Drugs.com = {{drugs.com|monograph|morphine-sulfate}}
| pregnancy_AU = C
| pregnancy_US = C
| legal_AU = S8
| legal_CA = Schedule I
| legal_US = Schedule II
| legal_UN = N I III
| legal_status = Prescription Medicine Only
| dependency_liability = High
| routes_of_administration = [[Inhalation]] ([[smoking]]), [[Insufflation (medicine)|insufflation]] (snorting), [[oral administration|oral]], [[rectal]], [[subcutaneous]] (S.C), [[intramuscular]] (I.M), [[intravenous]] (I.V), [[epidural]], and [[intrathecal]] (I.T.)
 
<!--Pharmacokinetic data-->
| bioavailability = 20–40% (oral), 36–71% (rectally),<ref name="pmid3387374">{{cite journal | author = Jonsson T, Christensen CB, Jordening H, Frølund C | title = The bioavailability of rectally administered morphine | journal = Pharmacol. Toxicol. | volume = 62 | issue = 4 | pages = 203–5 |date=April 1988 | pmid = 3387374 | doi = 10.1111/j.1600-0773.1988.tb01872.x }}</ref> 100% (IV/IM)
| protein_bound = 30–40%
| metabolism = [[Hepatic]] 90%
| elimination_half-life = 2–3 h
| excretion = Renal 90%, biliary 10%
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57-27-2
| CAS_supplemental = <br />64-31-3 (neutral sulfate),<br />52-26-6 (hydrochloride)
| ATC_prefix = N02
| ATC_suffix = AA01
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17303
| PubChem = 5288826
| IUPHAR_ligand = 1627
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00295
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4450907
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 76I7G6D29C
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08233
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 70
 
<!--Chemical data-->
| C=17 | H=19 | N=1 | O=3
| molecular_weight = 285.34
| smiles = CN1CC[C@]23C4=C5C=CC(O)=C4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5
| InChI = 1/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BQJCRHHNABKAKU-KBQPJGBKSA-N
| solubility = HCl & sulf.: 60
}}
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് '''മോർഫിൻ'''.
"https://ml.wikipedia.org/wiki/പ്രത്യേകം:മൊബൈൽവ്യത്യാസം/1930268" എന്ന താളിൽനിന്ന് ശേഖരിച്ചത്