"റോസുവാസ്റ്റാറ്റിൻ" എന്ന താളിന്റെ പതിപ്പുകൾ തമ്മിലുള്ള വ്യത്യാസം

2,070 ബൈറ്റുകൾ കൂട്ടിച്ചേർത്തിരിക്കുന്നു ,  7 വർഷം മുമ്പ്
തിരുത്തലിനു സംഗ്രഹമില്ല
(ചെ.)
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 464383832
| IUPAC_name = (3''R'',5''S'',6''E'')-7-[4-(4-fluorophenyl)-2-(''N''-methylmethanesulfonamido)-6-(propan-2-yl)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid
| image = Rosuvastatin-Formulae V 1.png
| width = 250
| image2 = Rosuvastatin3Dan.gif
| width2 = 250
 
<!--Clinical data-->
| tradename = Crestor, R2
| Drugs.com = {{drugs.com|monograph|crestor}}
| MedlinePlus = a603033
| pregnancy_AU = D
| pregnancy_US = X
| pregnancy_category = ll
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_status =
| routes_of_administration = oral
 
<!--Pharmacokinetic data-->
| bioavailability = 20%
| metabolism = [[Liver]]
| elimination_half-life = 19 h
| excretion = Urine / Faeces
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 287714-41-4
| ATC_prefix = C10
| ATC_suffix = AA07
| PubChem = 446157
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01098
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 393589
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 413KH5ZJ73
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D01915
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 38545
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1496
 
<!--Chemical data-->
| C=22 | H=28 | F=1 | N=3 | O=6 | S=1
| molecular_weight = 481.539
| smiles = O=S(=O)(N(c1nc(c(c(n1)C(C)C)/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)c2ccc(F)cc2)C)C
| InChI = 1/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1
| InChIKey = BPRHUIZQVSMCRT-VEUZHWNKBK
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = BPRHUIZQVSMCRT-VEUZHWNKSA-N
}}
[[രക്തം|രക്തത്തിലെ]] ഉയർന്ന [[കൊളസ്ട്രോൾ]] കുറയ്ക്കാൻ ഉപയോഗിക്കുന്ന മരുന്നാണ് '''റോസുവാസ്റ്റാറ്റിൻ'''. സ്റ്റാറ്റിൻ മരുന്നുകളുടെ കുടുംബത്തിലെ ഒരംഗം. [[കൊളസ്ട്രോൾ]] ഉത്പാദനം കുറച്ച് [[രക്തം|രക്ത]]ത്തിലെ [[കൊളസ്ട്രോൾ]] കുറക്കുന്നു.
<ref>http://www.ajconline.org/article/S0002-9149(01)01454-0/abstract</ref>
68

തിരുത്തലുകൾ

"https://ml.wikipedia.org/wiki/പ്രത്യേകം:മൊബൈൽവ്യത്യാസം/1917615" എന്ന താളിൽനിന്ന് ശേഖരിച്ചത്